C7H12O4 — CID 10080654
(2S,3R,4R)-2,4-dihydroxy-3-methoxycyclohexan-1-one (PubChem CID 10080654) has the molecular formula C7H12O4 and a molecular weight of 160.17 g/mol. Its IUPAC name is (2S,3R,4R)-2,4-dihydroxy-3-methoxycyclohexan-1-one.
| Compound Name | (2S,3R,4R)-2,4-dihydroxy-3-methoxycyclohexan-1-one |
|---|---|
| PubChem CID | 10080654 |
| Molecular Formula | C7H12O4 |
| Molecular Weight | 160.17 g/mol |
| Exact Mass | 160.07 |
| IUPAC Name | (2S,3R,4R)-2,4-dihydroxy-3-methoxycyclohexan-1-one |
| SMILES | CO[C@@H]1[C@H](O)CCC(=O)[C@H]1O |
| InChI | InChI=1S/C7H12O4/c1-11-7-5(9)3-2-4(8)6(7)10/h5-7,9-10H,2-3H2,1H3/t5-,6-,7-/m1/s1 |
| InChIKey | OYKZEFVOXJTEGT-FSDSQADBSA-N |
| XLogP | -0.91 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.17 |
| LogP ≤ 5 | -0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |