C24H19NO4S — CID 100820570
(4-acetamidonaphthalen-1-yl) 1,2-dihydroacenaphthylene-5-sulfonate (PubChem CID 100820570) has the molecular formula C24H19NO4S and a molecular weight of 417.49 g/mol. Its IUPAC name is (4-acetamidonaphthalen-1-yl) 1,2-dihydroacenaphthylene-5-sulfonate.
| Compound Name | (4-acetamidonaphthalen-1-yl) 1,2-dihydroacenaphthylene-5-sulfonate |
|---|---|
| PubChem CID | 100820570 |
| Molecular Formula | C24H19NO4S |
| Molecular Weight | 417.49 g/mol |
| Exact Mass | 417.10 |
| IUPAC Name | (4-acetamidonaphthalen-1-yl) 1,2-dihydroacenaphthylene-5-sulfonate |
| SMILES | CC(=O)Nc1ccc(OS(=O)(=O)c2ccc3c4c(cccc24)CC3)c2ccccc12 |
| InChI | InChI=1S/C24H19NO4S/c1-15(26)25-21-12-13-22(19-7-3-2-6-18(19)21)29-30(27,28)23-14-11-17-10-9-16-5-4-8-20(23)24(16)17/h2-8,11-14H,9-10H2,1H3,(H,25,26) |
| InChIKey | QWECVQCEXZRPHL-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.49 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|