C17H19N3 — CID 10084226
5-(cyclopropylmethyl)-6,11-dihydrobenzo[b][1,4]benzodiazepin-10-amine (PubChem CID 10084226) has the molecular formula C17H19N3 and a molecular weight of 265.36 g/mol. Its IUPAC name is 5-(cyclopropylmethyl)-6,11-dihydrobenzo[b][1,4]benzodiazepin-10-amine.
| Compound Name | 5-(cyclopropylmethyl)-6,11-dihydrobenzo[b][1,4]benzodiazepin-10-amine |
|---|---|
| PubChem CID | 10084226 |
| Molecular Formula | C17H19N3 |
| Molecular Weight | 265.36 g/mol |
| Exact Mass | 265.16 |
| IUPAC Name | 5-(cyclopropylmethyl)-6,11-dihydrobenzo[b][1,4]benzodiazepin-10-amine |
| SMILES | Nc1cccc2c1Nc1ccccc1N(CC1CC1)C2 |
| InChI | InChI=1S/C17H19N3/c18-14-5-3-4-13-11-20(10-12-8-9-12)16-7-2-1-6-15(16)19-17(13)14/h1-7,12,19H,8-11,18H2 |
| InChIKey | OUNDHFUQJKOTPN-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.36 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|