C13H9F3N2O — CID 10084242
6-[(E)-2-[4-(trifluoromethyl)phenyl]ethenyl]-1H-pyrimidin-2-one (PubChem CID 10084242) has the molecular formula C13H9F3N2O and a molecular weight of 266.22 g/mol. Its IUPAC name is 6-[(E)-2-[4-(trifluoromethyl)phenyl]ethenyl]-1H-pyrimidin-2-one.
| Compound Name | 6-[(E)-2-[4-(trifluoromethyl)phenyl]ethenyl]-1H-pyrimidin-2-one |
|---|---|
| PubChem CID | 10084242 |
| Molecular Formula | C13H9F3N2O |
| Molecular Weight | 266.22 g/mol |
| Exact Mass | 266.07 |
| IUPAC Name | 6-[(E)-2-[4-(trifluoromethyl)phenyl]ethenyl]-1H-pyrimidin-2-one |
| SMILES | O=c1nccc(/C=C/c2ccc(C(F)(F)F)cc2)[nH]1 |
| InChI | InChI=1S/C13H9F3N2O/c14-13(15,16)10-4-1-9(2-5-10)3-6-11-7-8-17-12(19)18-11/h1-8H,(H,17,18,19)/b6-3+ |
| InChIKey | MBTKSEXPTPPEJE-ZZXKWVIFSA-N |
| XLogP | 2.96 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.22 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |