C18H21ClN2O2 — CID 100851024
N-[(1S,8aS)-1,2,3,5,6,7,8,8a-octahydroindolizin-1-yl]-6-chloro-2H-chromene-3-carboxamide (PubChem CID 100851024) has the molecular formula C18H21ClN2O2 and a molecular weight of 332.83 g/mol. Its IUPAC name is N-[(1S,8aS)-1,2,3,5,6,7,8,8a-octahydroindolizin-1-yl]-6-chloro-2H-chromene-3-carboxamide.
| Compound Name | N-[(1S,8aS)-1,2,3,5,6,7,8,8a-octahydroindolizin-1-yl]-6-chloro-2H-chromene-3-carboxamide |
|---|---|
| PubChem CID | 100851024 |
| Molecular Formula | C18H21ClN2O2 |
| Molecular Weight | 332.83 g/mol |
| Exact Mass | 332.13 |
| IUPAC Name | N-[(1S,8aS)-1,2,3,5,6,7,8,8a-octahydroindolizin-1-yl]-6-chloro-2H-chromene-3-carboxamide |
| SMILES | O=C(N[C@H]1CCN2CCCC[C@@H]12)C1=Cc2cc(Cl)ccc2OC1 |
| InChI | InChI=1S/C18H21ClN2O2/c19-14-4-5-17-12(10-14)9-13(11-23-17)18(22)20-15-6-8-21-7-2-1-3-16(15)21/h4-5,9-10,15-16H,1-3,6-8,11H2,(H,20,22)/t15-,16-/m0/s1 |
| InChIKey | ZKUPEOFMUVCZRZ-HOTGVXAUSA-N |
| XLogP | 2.86 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.83 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |