C16H17N5O4 — CID 100852100
N-[(1S,2S,3R,4S)-3-carbamoyl-2-bicyclo[2.2.1]heptanyl]-5-nitro-1H-indazole-3-carboxamide (PubChem CID 100852100) has the molecular formula C16H17N5O4 and a molecular weight of 343.34 g/mol. Its IUPAC name is N-[(1S,2S,3R,4S)-3-carbamoyl-2-bicyclo[2.2.1]heptanyl]-5-nitro-1H-indazole-3-carboxamide.
| Compound Name | N-[(1S,2S,3R,4S)-3-carbamoyl-2-bicyclo[2.2.1]heptanyl]-5-nitro-1H-indazole-3-carboxamide |
|---|---|
| PubChem CID | 100852100 |
| Molecular Formula | C16H17N5O4 |
| Molecular Weight | 343.34 g/mol |
| Exact Mass | 343.13 |
| IUPAC Name | N-[(1S,2S,3R,4S)-3-carbamoyl-2-bicyclo[2.2.1]heptanyl]-5-nitro-1H-indazole-3-carboxamide |
| SMILES | NC(=O)[C@@H]1[C@H]2CC[C@@H](C2)[C@@H]1NC(=O)c1n[nH]c2ccc([N+](=O)[O-])cc12 |
| InChI | InChI=1S/C16H17N5O4/c17-15(22)12-7-1-2-8(5-7)13(12)18-16(23)14-10-6-9(21(24)25)3-4-11(10)19-20-14/h3-4,6-8,12-13H,1-2,5H2,(H2,17,22)(H,18,23)(H,19,20)/t7-,8-,12+,13-/m0/s1 |
| InChIKey | BMADHJWJQIPSFG-VLIVSTDHSA-N |
| XLogP | 1.10 |
| TPSA | 144.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.34 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|