C19H28O2 — CID 10085530
1,3,4,8,8,10a-hexamethyl-6,7,8a,9-tetrahydro-5H-xanthen-2-ol (PubChem CID 10085530) has the molecular formula C19H28O2 and a molecular weight of 288.43 g/mol. Its IUPAC name is 1,3,4,8,8,10a-hexamethyl-6,7,8a,9-tetrahydro-5H-xanthen-2-ol.
| Compound Name | 1,3,4,8,8,10a-hexamethyl-6,7,8a,9-tetrahydro-5H-xanthen-2-ol |
|---|---|
| PubChem CID | 10085530 |
| Molecular Formula | C19H28O2 |
| Molecular Weight | 288.43 g/mol |
| Exact Mass | 288.21 |
| IUPAC Name | 1,3,4,8,8,10a-hexamethyl-6,7,8a,9-tetrahydro-5H-xanthen-2-ol |
| SMILES | Cc1c(C)c2c(c(C)c1O)CC1C(C)(C)CCCC1(C)O2 |
| InChI | InChI=1S/C19H28O2/c1-11-12(2)17-14(13(3)16(11)20)10-15-18(4,5)8-7-9-19(15,6)21-17/h15,20H,7-10H2,1-6H3 |
| InChIKey | JUQKFPVJBHOWEY-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.43 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |