C17H22O3 — CID 11448727
(5aR,9aR)-5a,9,9-trimethyl-7,8,9a,10-tetrahydro-6H-[1,3]dioxolo[4,5-b]xanthene (PubChem CID 11448727) has the molecular formula C17H22O3 and a molecular weight of 274.36 g/mol. Its IUPAC name is (5aR,9aR)-5a,9,9-trimethyl-7,8,9a,10-tetrahydro-6H-[1,3]dioxolo[4,5-b]xanthene.
| Compound Name | (5aR,9aR)-5a,9,9-trimethyl-7,8,9a,10-tetrahydro-6H-[1,3]dioxolo[4,5-b]xanthene |
|---|---|
| PubChem CID | 11448727 |
| Molecular Formula | C17H22O3 |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.16 |
| IUPAC Name | (5aR,9aR)-5a,9,9-trimethyl-7,8,9a,10-tetrahydro-6H-[1,3]dioxolo[4,5-b]xanthene |
| SMILES | CC1(C)CCC[C@@]2(C)Oc3cc4c(cc3C[C@H]12)OCO4 |
| InChI | InChI=1S/C17H22O3/c1-16(2)5-4-6-17(3)15(16)8-11-7-13-14(19-10-18-13)9-12(11)20-17/h7,9,15H,4-6,8,10H2,1-3H3/t15-,17-/m1/s1 |
| InChIKey | AXEQWULTGMLAAS-NVXWUHKLSA-N |
| XLogP | 3.94 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |