C26H34O4 — CID 134959023
(14S,15R,19S)-10-hydroxy-5,15,19-trimethyl-6,21-dioxahexacyclo[17.3.3.01,18.02,15.05,14.07,12]pentacosa-7(12),8,10-trien-20-one (PubChem CID 134959023) has the molecular formula C26H34O4 and a molecular weight of 410.55 g/mol. Its IUPAC name is (14S,15R,19S)-10-hydroxy-5,15,19-trimethyl-6,21-dioxahexacyclo[17.3.3.01,18.02,15.05,14.07,12]pentacosa-7(12),8,10-trien-20-one.
| Compound Name | (14S,15R,19S)-10-hydroxy-5,15,19-trimethyl-6,21-dioxahexacyclo[17.3.3.01,18.02,15.05,14.07,12]pentacosa-7(12),8,10-trien-20-one |
|---|---|
| PubChem CID | 134959023 |
| Molecular Formula | C26H34O4 |
| Molecular Weight | 410.55 g/mol |
| Exact Mass | 410.25 |
| IUPAC Name | (14S,15R,19S)-10-hydroxy-5,15,19-trimethyl-6,21-dioxahexacyclo[17.3.3.01,18.02,15.05,14.07,12]pentacosa-7(12),8,10-trien-20-one |
| SMILES | CC12CCC3C45CCC[C@](C)(C(=O)OC4)C5CC[C@@]3(C)[C@@H]1Cc1cc(O)ccc1O2 |
| InChI | InChI=1S/C26H34O4/c1-23-11-7-20-24(2)9-4-10-26(20,15-29-22(24)28)19(23)8-12-25(3)21(23)14-16-13-17(27)5-6-18(16)30-25/h5-6,13,19-21,27H,4,7-12,14-15H2,1-3H3/t19?,20?,21-,23+,24-,25?,26?/m0/s1 |
| InChIKey | HFVKLEZASUROTL-YAMOUIATSA-N |
| XLogP | 5.26 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.55 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |