C14H24O4S2 — CID 10087381
(3'aR,4'R,8'S,8'aR)-4'-methoxy-2',2'-dimethylspiro[1,3-dithiane-2,6'-3a,4,5,7,8,8a-hexahydrocyclohepta[d][1,3]dioxole]-8'-ol (PubChem CID 10087381) has the molecular formula C14H24O4S2 and a molecular weight of 320.48 g/mol. Its IUPAC name is (3'aR,4'R,8'S,8'aR)-4'-methoxy-2',2'-dimethylspiro[1,3-dithiane-2,6'-3a,4,5,7,8,8a-hexahydrocyclohepta[d][1,3]dioxole]-8'-ol.
| Compound Name | (3'aR,4'R,8'S,8'aR)-4'-methoxy-2',2'-dimethylspiro[1,3-dithiane-2,6'-3a,4,5,7,8,8a-hexahydrocyclohepta[d][1,3]dioxole]-8'-ol |
|---|---|
| PubChem CID | 10087381 |
| Molecular Formula | C14H24O4S2 |
| Molecular Weight | 320.48 g/mol |
| Exact Mass | 320.11 |
| IUPAC Name | (3'aR,4'R,8'S,8'aR)-4'-methoxy-2',2'-dimethylspiro[1,3-dithiane-2,6'-3a,4,5,7,8,8a-hexahydrocyclohepta[d][1,3]dioxole]-8'-ol |
| SMILES | CO[C@@H]1CC2(C[C@H](O)[C@H]3OC(C)(C)O[C@@H]31)SCCCS2 |
| InChI | InChI=1S/C14H24O4S2/c1-13(2)17-11-9(15)7-14(19-5-4-6-20-14)8-10(16-3)12(11)18-13/h9-12,15H,4-8H2,1-3H3/t9-,10+,11+,12+/m0/s1 |
| InChIKey | BTBWCTZIKSVWRJ-IRCOFANPSA-N |
| XLogP | 2.24 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.48 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |