C9H16O5S2 — CID 14353192
(2S,3S,4S,5R,6S)-2-(1,3-dithiolan-2-yl)-6-methoxyoxane-3,4,5-triol (PubChem CID 14353192) has the molecular formula C9H16O5S2 and a molecular weight of 268.36 g/mol. Its IUPAC name is (2S,3S,4S,5R,6S)-2-(1,3-dithiolan-2-yl)-6-methoxyoxane-3,4,5-triol.
| Compound Name | (2S,3S,4S,5R,6S)-2-(1,3-dithiolan-2-yl)-6-methoxyoxane-3,4,5-triol |
|---|---|
| PubChem CID | 14353192 |
| Molecular Formula | C9H16O5S2 |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.04 |
| IUPAC Name | (2S,3S,4S,5R,6S)-2-(1,3-dithiolan-2-yl)-6-methoxyoxane-3,4,5-triol |
| SMILES | CO[C@H]1O[C@H](C2SCCS2)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C9H16O5S2/c1-13-8-6(12)4(10)5(11)7(14-8)9-15-2-3-16-9/h4-12H,2-3H2,1H3/t4-,5-,6+,7-,8-/m0/s1 |
| InChIKey | GIDLEIVUOGUTRM-RLMOJYMMSA-N |
| XLogP | -0.75 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |