C24H26N2O7 — CID 100883355
[(13S,21S)-20-acetyl-16,17-dimethoxy-21-methyl-5,7-dioxa-1,20-diazapentacyclo[11.8.0.02,10.04,8.014,19]henicosa-2,4(8),9,14,16,18-hexaen-21-yl] acetate (PubChem CID 100883355) has the molecular formula C24H26N2O7 and a molecular weight of 454.48 g/mol. Its IUPAC name is [(13S,21S)-20-acetyl-16,17-dimethoxy-21-methyl-5,7-dioxa-1,20-diazapentacyclo[11.8.0.02,10.04,8.014,19]henicosa-2,4(8),9,14,16,18-hexaen-21-yl] acetate.
| Compound Name | [(13S,21S)-20-acetyl-16,17-dimethoxy-21-methyl-5,7-dioxa-1,20-diazapentacyclo[11.8.0.02,10.04,8.014,19]henicosa-2,4(8),9,14,16,18-hexaen-21-yl] acetate |
|---|---|
| PubChem CID | 100883355 |
| Molecular Formula | C24H26N2O7 |
| Molecular Weight | 454.48 g/mol |
| Exact Mass | 454.17 |
| IUPAC Name | [(13S,21S)-20-acetyl-16,17-dimethoxy-21-methyl-5,7-dioxa-1,20-diazapentacyclo[11.8.0.02,10.04,8.014,19]henicosa-2,4(8),9,14,16,18-hexaen-21-yl] acetate |
| SMILES | COc1cc2c(cc1OC)N(C(C)=O)[C@@](C)(OC(C)=O)N1c3cc4c(cc3CC[C@@H]21)OCO4 |
| InChI | InChI=1S/C24H26N2O7/c1-13(27)25-19-11-21(30-5)20(29-4)9-16(19)17-7-6-15-8-22-23(32-12-31-22)10-18(15)26(17)24(25,3)33-14(2)28/h8-11,17H,6-7,12H2,1-5H3/t17-,24+/m0/s1 |
| InChIKey | LWYBAEZAWAZUJM-BXKMTCNYSA-N |
| XLogP | 3.53 |
| TPSA | 86.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.48 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|