C19H20FN3O2 — CID 10088693
3-[4-[3-(6-fluoro-2-pyridinyl)propoxy]-3,5-dimethylphenyl]-5-methyl-1,2,4-oxadiazole (PubChem CID 10088693) has the molecular formula C19H20FN3O2 and a molecular weight of 341.39 g/mol. Its IUPAC name is 3-[4-[3-(6-fluoro-2-pyridinyl)propoxy]-3,5-dimethylphenyl]-5-methyl-1,2,4-oxadiazole.
| Compound Name | 3-[4-[3-(6-fluoro-2-pyridinyl)propoxy]-3,5-dimethylphenyl]-5-methyl-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 10088693 |
| Molecular Formula | C19H20FN3O2 |
| Molecular Weight | 341.39 g/mol |
| Exact Mass | 341.15 |
| IUPAC Name | 3-[4-[3-(6-fluoro-2-pyridinyl)propoxy]-3,5-dimethylphenyl]-5-methyl-1,2,4-oxadiazole |
| SMILES | Cc1nc(-c2cc(C)c(OCCCc3cccc(F)n3)c(C)c2)no1 |
| InChI | InChI=1S/C19H20FN3O2/c1-12-10-15(19-21-14(3)25-23-19)11-13(2)18(12)24-9-5-7-16-6-4-8-17(20)22-16/h4,6,8,10-11H,5,7,9H2,1-3H3 |
| InChIKey | BZWGTDMEFUDHCF-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 61.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.39 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|