C16H18N4O2S — CID 67661909
3-[3,5-dimethyl-4-[3-(1,3,4-thiadiazol-2-yl)propoxy]phenyl]-5-methyl-1,2,4-oxadiazole (PubChem CID 67661909) has the molecular formula C16H18N4O2S and a molecular weight of 330.41 g/mol. Its IUPAC name is 3-[3,5-dimethyl-4-[3-(1,3,4-thiadiazol-2-yl)propoxy]phenyl]-5-methyl-1,2,4-oxadiazole.
| Compound Name | 3-[3,5-dimethyl-4-[3-(1,3,4-thiadiazol-2-yl)propoxy]phenyl]-5-methyl-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 67661909 |
| Molecular Formula | C16H18N4O2S |
| Molecular Weight | 330.41 g/mol |
| Exact Mass | 330.12 |
| IUPAC Name | 3-[3,5-dimethyl-4-[3-(1,3,4-thiadiazol-2-yl)propoxy]phenyl]-5-methyl-1,2,4-oxadiazole |
| SMILES | Cc1nc(-c2cc(C)c(OCCCc3nncs3)c(C)c2)no1 |
| InChI | InChI=1S/C16H18N4O2S/c1-10-7-13(16-18-12(3)22-20-16)8-11(2)15(10)21-6-4-5-14-19-17-9-23-14/h7-9H,4-6H2,1-3H3 |
| InChIKey | CEGKOTJXZFAAAF-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 73.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.41 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|