C14H12Cl2N2O2 — CID 10425550
3-(3,5-dichloro-4-pent-4-ynoxyphenyl)-5-methyl-1,2,4-oxadiazole (PubChem CID 10425550) has the molecular formula C14H12Cl2N2O2 and a molecular weight of 311.17 g/mol. Its IUPAC name is 3-(3,5-dichloro-4-pent-4-ynoxyphenyl)-5-methyl-1,2,4-oxadiazole.
| Compound Name | 3-(3,5-dichloro-4-pent-4-ynoxyphenyl)-5-methyl-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 10425550 |
| Molecular Formula | C14H12Cl2N2O2 |
| Molecular Weight | 311.17 g/mol |
| Exact Mass | 310.03 |
| IUPAC Name | 3-(3,5-dichloro-4-pent-4-ynoxyphenyl)-5-methyl-1,2,4-oxadiazole |
| SMILES | C#CCCCOc1c(Cl)cc(-c2noc(C)n2)cc1Cl |
| InChI | InChI=1S/C14H12Cl2N2O2/c1-3-4-5-6-19-13-11(15)7-10(8-12(13)16)14-17-9(2)20-18-14/h1,7-8H,4-6H2,2H3 |
| InChIKey | PMPGUCDGDMARMQ-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 48.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.17 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|