C20H32N2O3 — CID 100893863
[(5S,7R)-3-[[(3R)-1-methylpiperidin-3-yl]methylcarbamoyl]-1-adamantyl] acetate (PubChem CID 100893863) has the molecular formula C20H32N2O3 and a molecular weight of 348.49 g/mol. Its IUPAC name is [(5S,7R)-3-[[(3R)-1-methylpiperidin-3-yl]methylcarbamoyl]-1-adamantyl] acetate.
| Compound Name | [(5S,7R)-3-[[(3R)-1-methylpiperidin-3-yl]methylcarbamoyl]-1-adamantyl] acetate |
|---|---|
| PubChem CID | 100893863 |
| Molecular Formula | C20H32N2O3 |
| Molecular Weight | 348.49 g/mol |
| Exact Mass | 348.24 |
| IUPAC Name | [(5S,7R)-3-[[(3R)-1-methylpiperidin-3-yl]methylcarbamoyl]-1-adamantyl] acetate |
| SMILES | CC(=O)OC12C[C@H]3C[C@@H](C1)CC(C(=O)NC[C@H]1CCCN(C)C1)(C3)C2 |
| InChI | InChI=1S/C20H32N2O3/c1-14(23)25-20-9-16-6-17(10-20)8-19(7-16,13-20)18(24)21-11-15-4-3-5-22(2)12-15/h15-17H,3-13H2,1-2H3,(H,21,24)/t15-,16-,17+,19?,20?/m1/s1 |
| InChIKey | BJNMHNQGVQRNRY-JMLUXXDHSA-N |
| XLogP | 2.35 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.49 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |