C8H3ClF10N2 — CID 10089388
5-(5-chloro-1,1,2,2,3,3,4,4,5,5-decafluoropentyl)-1H-pyrazole (PubChem CID 10089388) has the molecular formula C8H3ClF10N2 and a molecular weight of 352.56 g/mol. Its IUPAC name is 5-(5-chloro-1,1,2,2,3,3,4,4,5,5-decafluoropentyl)-1H-pyrazole.
| Compound Name | 5-(5-chloro-1,1,2,2,3,3,4,4,5,5-decafluoropentyl)-1H-pyrazole |
|---|---|
| PubChem CID | 10089388 |
| Molecular Formula | C8H3ClF10N2 |
| Molecular Weight | 352.56 g/mol |
| Exact Mass | 351.98 |
| IUPAC Name | 5-(5-chloro-1,1,2,2,3,3,4,4,5,5-decafluoropentyl)-1H-pyrazole |
| SMILES | FC(F)(Cl)C(F)(F)C(F)(F)C(F)(F)C(F)(F)c1ccn[nH]1 |
| InChI | InChI=1S/C8H3ClF10N2/c9-8(18,19)7(16,17)6(14,15)5(12,13)4(10,11)3-1-2-20-21-3/h1-2H,(H,20,21) |
| InChIKey | QQUJBQJAUBDOGT-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.56 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|