About 1H-indol-5-amine;5-(trifluoromethyl)-1H-pyrazole
1H-indol-5-amine;5-(trifluoromethyl)-1H-pyrazole (PubChem CID 157068873) has the molecular formula C12H11F3N4
and a molecular weight of 268.24 g/mol. Its IUPAC name is 1H-indol-5-amine;5-(trifluoromethyl)-1H-pyrazole.
Molecular Properties
| Compound Name | 1H-indol-5-amine;5-(trifluoromethyl)-1H-pyrazole |
| PubChem CID | 157068873 |
| Molecular Formula | C12H11F3N4 |
| Molecular Weight | 268.24 g/mol |
| Exact Mass | 268.09 |
| IUPAC Name | 1H-indol-5-amine;5-(trifluoromethyl)-1H-pyrazole |
| SMILES | FC(F)(F)c1ccn[nH]1.Nc1ccc2[nH]ccc2c1 |
| InChI | InChI=1S/C8H8N2.C4H3F3N2/c9-7-1-2-8-6(5-7)3-4-10-8;5-4(6,7)3-1-2-8-9-3/h1-5,10H,9H2;1-2H,(H,8,9) |
| InChIKey | ACERRTLAFSMNJO-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 70.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.24 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 1H-indol-5-amine;5-(trifluoromethyl)-1H-pyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-indol-5-amine;5-(trifluoromethyl)-1H-pyrazole?
The IUPAC name of 1H-indol-5-amine;5-(trifluoromethyl)-1H-pyrazole (CID 157068873) is 1H-indol-5-amine;5-(trifluoromethyl)-1H-pyrazole.
What is the SMILES notation for 1H-indol-5-amine;5-(trifluoromethyl)-1H-pyrazole?
The canonical SMILES for 1H-indol-5-amine;5-(trifluoromethyl)-1H-pyrazole is FC(F)(F)c1ccn[nH]1.Nc1ccc2[nH]ccc2c1.
What is the InChIKey of 1H-indol-5-amine;5-(trifluoromethyl)-1H-pyrazole?
The InChIKey is ACERRTLAFSMNJO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N2.C4H3F3N2/c9-7-1-2-8-6(5-7)3-4-10-8;5-4(6,7)3-1-2-8-9-3/h1-5,10H,9H2;1-2H,(H,8,9).
What are the key properties of 1H-indol-5-amine;5-(trifluoromethyl)-1H-pyrazole?
1H-indol-5-amine;5-(trifluoromethyl)-1H-pyrazole has a molecular weight of 268.24 g/mol, XLogP of 3.18, 0 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-indol-5-amine;5-(trifluoromethyl)-1H-pyrazole is sourced from PubChem (CID 157068873), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).