C13H8ClF12N — CID 11102269
2-(6-chloro-1,1,2,2,3,3,4,4,5,5,6,6-dodecafluorohexyl)-3,5-dimethylpyridine (PubChem CID 11102269) has the molecular formula C13H8ClF12N and a molecular weight of 441.64 g/mol. Its IUPAC name is 2-(6-chloro-1,1,2,2,3,3,4,4,5,5,6,6-dodecafluorohexyl)-3,5-dimethylpyridine.
| Compound Name | 2-(6-chloro-1,1,2,2,3,3,4,4,5,5,6,6-dodecafluorohexyl)-3,5-dimethylpyridine |
|---|---|
| PubChem CID | 11102269 |
| Molecular Formula | C13H8ClF12N |
| Molecular Weight | 441.64 g/mol |
| Exact Mass | 441.02 |
| IUPAC Name | 2-(6-chloro-1,1,2,2,3,3,4,4,5,5,6,6-dodecafluorohexyl)-3,5-dimethylpyridine |
| SMILES | Cc1cnc(C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)Cl)c(C)c1 |
| InChI | InChI=1S/C13H8ClF12N/c1-5-3-6(2)7(27-4-5)8(15,16)9(17,18)10(19,20)11(21,22)12(23,24)13(14,25)26/h3-4H,1-2H3 |
| InChIKey | OBGVXTUCRLYCRJ-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.64 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|