C16H26N4O3 — CID 100895387
(4aR,7aR)-N-[[3-[(1R)-1-ethoxyethyl]-1,2,4-oxadiazol-5-yl]methyl]-2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyridine-1-carboxamide (PubChem CID 100895387) has the molecular formula C16H26N4O3 and a molecular weight of 322.41 g/mol. Its IUPAC name is (4aR,7aR)-N-[[3-[(1R)-1-ethoxyethyl]-1,2,4-oxadiazol-5-yl]methyl]-2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyridine-1-carboxamide.
| Compound Name | (4aR,7aR)-N-[[3-[(1R)-1-ethoxyethyl]-1,2,4-oxadiazol-5-yl]methyl]-2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyridine-1-carboxamide |
|---|---|
| PubChem CID | 100895387 |
| Molecular Formula | C16H26N4O3 |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.20 |
| IUPAC Name | (4aR,7aR)-N-[[3-[(1R)-1-ethoxyethyl]-1,2,4-oxadiazol-5-yl]methyl]-2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyridine-1-carboxamide |
| SMILES | CCO[C@H](C)c1noc(CNC(=O)N2CCC[C@H]3CCC[C@H]32)n1 |
| InChI | InChI=1S/C16H26N4O3/c1-3-22-11(2)15-18-14(23-19-15)10-17-16(21)20-9-5-7-12-6-4-8-13(12)20/h11-13H,3-10H2,1-2H3,(H,17,21)/t11-,12-,13-/m1/s1 |
| InChIKey | WCJCBZLXCXTSMP-JHJVBQTASA-N |
| XLogP | 2.64 |
| TPSA | 80.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |