C15H24N4O3 — CID 95975973
1-[[(1R)-cyclohex-3-en-1-yl]methyl]-3-[[3-[(1R)-1-ethoxyethyl]-1,2,4-oxadiazol-5-yl]methyl]urea (PubChem CID 95975973) has the molecular formula C15H24N4O3 and a molecular weight of 308.38 g/mol. Its IUPAC name is 1-[[(1R)-cyclohex-3-en-1-yl]methyl]-3-[[3-[(1R)-1-ethoxyethyl]-1,2,4-oxadiazol-5-yl]methyl]urea.
| Compound Name | 1-[[(1R)-cyclohex-3-en-1-yl]methyl]-3-[[3-[(1R)-1-ethoxyethyl]-1,2,4-oxadiazol-5-yl]methyl]urea |
|---|---|
| PubChem CID | 95975973 |
| Molecular Formula | C15H24N4O3 |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.18 |
| IUPAC Name | 1-[[(1R)-cyclohex-3-en-1-yl]methyl]-3-[[3-[(1R)-1-ethoxyethyl]-1,2,4-oxadiazol-5-yl]methyl]urea |
| SMILES | CCO[C@H](C)c1noc(CNC(=O)NC[C@H]2CC=CCC2)n1 |
| InChI | InChI=1S/C15H24N4O3/c1-3-21-11(2)14-18-13(22-19-14)10-17-15(20)16-9-12-7-5-4-6-8-12/h4-5,11-12H,3,6-10H2,1-2H3,(H2,16,17,20)/t11-,12+/m1/s1 |
| InChIKey | JNYJDTACKXRVQH-NEPJUHHUSA-N |
| XLogP | 2.32 |
| TPSA | 89.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|