C15H27N5O3 — CID 109384545
3-[[3-(1-ethoxyethyl)-1,2,4-oxadiazol-5-yl]methyl]-1,2-dimethyl-1-(oxolan-3-ylmethyl)guanidine (PubChem CID 109384545) has the molecular formula C15H27N5O3 and a molecular weight of 325.41 g/mol. Its IUPAC name is 3-[[3-(1-ethoxyethyl)-1,2,4-oxadiazol-5-yl]methyl]-1,2-dimethyl-1-(oxolan-3-ylmethyl)guanidine.
| Compound Name | 3-[[3-(1-ethoxyethyl)-1,2,4-oxadiazol-5-yl]methyl]-1,2-dimethyl-1-(oxolan-3-ylmethyl)guanidine |
|---|---|
| PubChem CID | 109384545 |
| Molecular Formula | C15H27N5O3 |
| Molecular Weight | 325.41 g/mol |
| Exact Mass | 325.21 |
| IUPAC Name | 3-[[3-(1-ethoxyethyl)-1,2,4-oxadiazol-5-yl]methyl]-1,2-dimethyl-1-(oxolan-3-ylmethyl)guanidine |
| SMILES | CCOC(C)c1noc(CN/C(=N/C)N(C)CC2CCOC2)n1 |
| InChI | InChI=1S/C15H27N5O3/c1-5-22-11(2)14-18-13(23-19-14)8-17-15(16-3)20(4)9-12-6-7-21-10-12/h11-12H,5-10H2,1-4H3,(H,16,17) |
| InChIKey | OCCGGSHSDSTBJN-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 85.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.41 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|