C13H21ClO2S — CID 100895874
(1R,7S,12R)-12-chloro-13λ6-thiatricyclo[5.4.3.01,7]tetradecane 13,13-dioxide (PubChem CID 100895874) has the molecular formula C13H21ClO2S and a molecular weight of 276.83 g/mol. Its IUPAC name is (1R,7S,12R)-12-chloro-13λ6-thiatricyclo[5.4.3.01,7]tetradecane 13,13-dioxide.
| Compound Name | (1R,7S,12R)-12-chloro-13λ6-thiatricyclo[5.4.3.01,7]tetradecane 13,13-dioxide |
|---|---|
| PubChem CID | 100895874 |
| Molecular Formula | C13H21ClO2S |
| Molecular Weight | 276.83 g/mol |
| Exact Mass | 276.10 |
| IUPAC Name | (1R,7S,12R)-12-chloro-13λ6-thiatricyclo[5.4.3.01,7]tetradecane 13,13-dioxide |
| SMILES | O=S1(=O)C[C@]23CCCCC[C@]2(CCCC3)[C@H]1Cl |
| InChI | InChI=1S/C13H21ClO2S/c14-11-13-8-3-1-2-6-12(13,7-4-5-9-13)10-17(11,15)16/h11H,1-10H2/t11-,12+,13-/m0/s1 |
| InChIKey | DOUPBQQCXWICIO-XQQFMLRXSA-N |
| XLogP | 3.49 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.83 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|