C13H19ClO2S — CID 98164170
(1R,6R,7S)-7-chloro-11,11-dimethyl-8λ6-thiatricyclo[4.3.3.01,6]dodec-3-ene 8,8-dioxide (PubChem CID 98164170) has the molecular formula C13H19ClO2S and a molecular weight of 274.81 g/mol. Its IUPAC name is (1R,6R,7S)-7-chloro-11,11-dimethyl-8λ6-thiatricyclo[4.3.3.01,6]dodec-3-ene 8,8-dioxide.
| Compound Name | (1R,6R,7S)-7-chloro-11,11-dimethyl-8λ6-thiatricyclo[4.3.3.01,6]dodec-3-ene 8,8-dioxide |
|---|---|
| PubChem CID | 98164170 |
| Molecular Formula | C13H19ClO2S |
| Molecular Weight | 274.81 g/mol |
| Exact Mass | 274.08 |
| IUPAC Name | (1R,6R,7S)-7-chloro-11,11-dimethyl-8λ6-thiatricyclo[4.3.3.01,6]dodec-3-ene 8,8-dioxide |
| SMILES | CC1(C)C[C@]23CC=CC[C@]2(C1)[C@H](Cl)S(=O)(=O)C3 |
| InChI | InChI=1S/C13H19ClO2S/c1-11(2)7-12-5-3-4-6-13(12,8-11)10(14)17(15,16)9-12/h3-4,10H,5-9H2,1-2H3/t10-,12+,13+/m1/s1 |
| InChIKey | AMCLXVINJFAWJQ-WXHSDQCUSA-N |
| XLogP | 3.12 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.81 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|