C13H20S — CID 94034911
(1R,6S,11R)-11-methyl-12-thiatricyclo[4.4.3.01,6]tridec-3-ene (PubChem CID 94034911) has the molecular formula C13H20S and a molecular weight of 208.37 g/mol. Its IUPAC name is (1R,6S,11R)-11-methyl-12-thiatricyclo[4.4.3.01,6]tridec-3-ene.
| Compound Name | (1R,6S,11R)-11-methyl-12-thiatricyclo[4.4.3.01,6]tridec-3-ene |
|---|---|
| PubChem CID | 94034911 |
| Molecular Formula | C13H20S |
| Molecular Weight | 208.37 g/mol |
| Exact Mass | 208.13 |
| IUPAC Name | (1R,6S,11R)-11-methyl-12-thiatricyclo[4.4.3.01,6]tridec-3-ene |
| SMILES | C[C@H]1SC[C@@]23CC=CC[C@@]12CCCC3 |
| InChI | InChI=1S/C13H20S/c1-11-13-8-4-2-6-12(13,10-14-11)7-3-5-9-13/h2,4,11H,3,5-10H2,1H3/t11-,12+,13-/m1/s1 |
| InChIKey | SRWYIEUTFKSUCL-FRRDWIJNSA-N |
| XLogP | 4.02 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.37 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|