C12H18N2O — CID 94037220
(1S,6R)-12-nitroso-12-azatricyclo[4.4.3.01,6]tridec-3-ene (PubChem CID 94037220) has the molecular formula C12H18N2O and a molecular weight of 206.29 g/mol. Its IUPAC name is (1S,6R)-12-nitroso-12-azatricyclo[4.4.3.01,6]tridec-3-ene.
| Compound Name | (1S,6R)-12-nitroso-12-azatricyclo[4.4.3.01,6]tridec-3-ene |
|---|---|
| PubChem CID | 94037220 |
| Molecular Formula | C12H18N2O |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.14 |
| IUPAC Name | (1S,6R)-12-nitroso-12-azatricyclo[4.4.3.01,6]tridec-3-ene |
| SMILES | O=NN1C[C@@]23CC=CC[C@@]2(CCCC3)C1 |
| InChI | InChI=1S/C12H18N2O/c15-13-14-9-11-5-1-2-6-12(11,10-14)8-4-3-7-11/h1-2H,3-10H2/t11-,12+ |
| InChIKey | PSFGOJUFEIYFLX-TXEJJXNPSA-N |
| XLogP | 2.88 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'} |
|---|