C13H14O3 — CID 90482245
tricyclo[4.4.3.01,6]tridec-3-ene-11,12,13-trione (PubChem CID 90482245) has the molecular formula C13H14O3 and a molecular weight of 218.25 g/mol. Its IUPAC name is tricyclo[4.4.3.01,6]tridec-3-ene-11,12,13-trione.
| Compound Name | tricyclo[4.4.3.01,6]tridec-3-ene-11,12,13-trione |
|---|---|
| PubChem CID | 90482245 |
| Molecular Formula | C13H14O3 |
| Molecular Weight | 218.25 g/mol |
| Exact Mass | 218.09 |
| IUPAC Name | tricyclo[4.4.3.01,6]tridec-3-ene-11,12,13-trione |
| SMILES | O=C1C(=O)C23CC=CCC2(CCCC3)C1=O |
| InChI | InChI=1S/C13H14O3/c14-9-10(15)12-5-1-2-6-13(12,11(9)16)8-4-3-7-12/h1-2H,3-8H2 |
| InChIKey | CQKNEAQLVZAGAO-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.25 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|