C24H32N4 — CID 134081582
(E)-bis(12-azatricyclo[4.4.3.01,6]trideca-2,4-dien-12-yl)diazene (PubChem CID 134081582) has the molecular formula C24H32N4 and a molecular weight of 376.55 g/mol. Its IUPAC name is (E)-bis(12-azatricyclo[4.4.3.01,6]trideca-2,4-dien-12-yl)diazene.
| Compound Name | (E)-bis(12-azatricyclo[4.4.3.01,6]trideca-2,4-dien-12-yl)diazene |
|---|---|
| PubChem CID | 134081582 |
| Molecular Formula | C24H32N4 |
| Molecular Weight | 376.55 g/mol |
| Exact Mass | 376.26 |
| IUPAC Name | (E)-bis(12-azatricyclo[4.4.3.01,6]trideca-2,4-dien-12-yl)diazene |
| SMILES | C1=CC23CCCCC2(C=C1)CN(/N=N/N1CC24C=CC=CC2(CCCC4)C1)C3 |
| InChI | InChI=1S/C24H32N4/c1-2-10-22-12-4-3-11-21(22,9-1)17-27(18-22)25-26-28-19-23-13-5-6-14-24(23,20-28)16-8-7-15-23/h1-2,5-6,9-10,13-14H,3-4,7-8,11-12,15-20H2/b26-25+ |
| InChIKey | WCSNKQPGRWYFHU-OCEACIFDSA-N |
| XLogP | 5.25 |
| TPSA | 31.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.55 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|