C12H18O — CID 98162193
(1R,3R,6R)-tricyclo[4.4.2.01,6]dodec-11-en-3-ol (PubChem CID 98162193) has the molecular formula C12H18O and a molecular weight of 178.27 g/mol. Its IUPAC name is (1R,3R,6R)-tricyclo[4.4.2.01,6]dodec-11-en-3-ol.
| Compound Name | (1R,3R,6R)-tricyclo[4.4.2.01,6]dodec-11-en-3-ol |
|---|---|
| PubChem CID | 98162193 |
| Molecular Formula | C12H18O |
| Molecular Weight | 178.27 g/mol |
| Exact Mass | 178.14 |
| IUPAC Name | (1R,3R,6R)-tricyclo[4.4.2.01,6]dodec-11-en-3-ol |
| SMILES | O[C@@H]1CC[C@]23C=C[C@@]2(CCCC3)C1 |
| InChI | InChI=1S/C12H18O/c13-10-3-6-11-4-1-2-5-12(11,9-10)8-7-11/h7-8,10,13H,1-6,9H2/t10-,11-,12+/m1/s1 |
| InChIKey | QFYIUKGKAKXHIP-UTUOFQBUSA-N |
| XLogP | 2.65 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.27 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|