C12H20O — CID 98162186
(1S,3R,6R)-tricyclo[4.4.2.01,6]dodecan-3-ol (PubChem CID 98162186) has the molecular formula C12H20O and a molecular weight of 180.29 g/mol. Its IUPAC name is (1S,3R,6R)-tricyclo[4.4.2.01,6]dodecan-3-ol.
| Compound Name | (1S,3R,6R)-tricyclo[4.4.2.01,6]dodecan-3-ol |
|---|---|
| PubChem CID | 98162186 |
| Molecular Formula | C12H20O |
| Molecular Weight | 180.29 g/mol |
| Exact Mass | 180.15 |
| IUPAC Name | (1S,3R,6R)-tricyclo[4.4.2.01,6]dodecan-3-ol |
| SMILES | O[C@@H]1CC[C@]23CCCC[C@]2(CC3)C1 |
| InChI | InChI=1S/C12H20O/c13-10-3-6-11-4-1-2-5-12(11,9-10)8-7-11/h10,13H,1-9H2/t10-,11+,12+/m1/s1 |
| InChIKey | GKVCHKMWBWGAAV-WOPDTQHZSA-N |
| XLogP | 2.87 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.29 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |