C10H16O — CID 131155644
(1R,6S,7R)-tricyclo[4.3.1.01,6]decan-7-ol (PubChem CID 131155644) has the molecular formula C10H16O and a molecular weight of 152.24 g/mol. Its IUPAC name is (1R,6S,7R)-tricyclo[4.3.1.01,6]decan-7-ol.
| Compound Name | (1R,6S,7R)-tricyclo[4.3.1.01,6]decan-7-ol |
|---|---|
| PubChem CID | 131155644 |
| Molecular Formula | C10H16O |
| Molecular Weight | 152.24 g/mol |
| Exact Mass | 152.12 |
| IUPAC Name | (1R,6S,7R)-tricyclo[4.3.1.01,6]decan-7-ol |
| SMILES | O[C@@H]1CC[C@@]23CCCC[C@@]12C3 |
| InChI | InChI=1S/C10H16O/c11-8-3-6-9-4-1-2-5-10(8,9)7-9/h8,11H,1-7H2/t8-,9-,10-/m1/s1 |
| InChIKey | LAJXRAIMEATBOB-OPRDCNLKSA-N |
| XLogP | 2.09 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.24 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |