C11H18O — CID 13404803
(1S,2R,6R)-tricyclo[4.3.2.01,6]undecan-2-ol (PubChem CID 13404803) has the molecular formula C11H18O and a molecular weight of 166.26 g/mol. Its IUPAC name is (1S,2R,6R)-tricyclo[4.3.2.01,6]undecan-2-ol.
| Compound Name | (1S,2R,6R)-tricyclo[4.3.2.01,6]undecan-2-ol |
|---|---|
| PubChem CID | 13404803 |
| Molecular Formula | C11H18O |
| Molecular Weight | 166.26 g/mol |
| Exact Mass | 166.14 |
| IUPAC Name | (1S,2R,6R)-tricyclo[4.3.2.01,6]undecan-2-ol |
| SMILES | O[C@@H]1CCC[C@@]23CCC[C@@]12CC3 |
| InChI | InChI=1S/C11H18O/c12-9-3-1-4-10-5-2-6-11(9,10)8-7-10/h9,12H,1-8H2/t9-,10+,11-/m1/s1 |
| InChIKey | ZTBGPHWJFFKHOR-OUAUKWLOSA-N |
| XLogP | 2.48 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.26 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |