C12H20O2 — CID 102268829
(7S,11R)-tricyclo[4.3.3.01,6]dodecane-7,11-diol (PubChem CID 102268829) has the molecular formula C12H20O2 and a molecular weight of 196.29 g/mol. Its IUPAC name is (7S,11R)-tricyclo[4.3.3.01,6]dodecane-7,11-diol.
| Compound Name | (7S,11R)-tricyclo[4.3.3.01,6]dodecane-7,11-diol |
|---|---|
| PubChem CID | 102268829 |
| Molecular Formula | C12H20O2 |
| Molecular Weight | 196.29 g/mol |
| Exact Mass | 196.15 |
| IUPAC Name | (7S,11R)-tricyclo[4.3.3.01,6]dodecane-7,11-diol |
| SMILES | O[C@@H]1CC23CCCCC2(C1)[C@@H](O)CC3 |
| InChI | InChI=1S/C12H20O2/c13-9-7-11-4-1-2-5-12(11,8-9)10(14)3-6-11/h9-10,13-14H,1-8H2/t9-,10+,11?,12?/m1/s1 |
| InChIKey | ONOIVHPXEURVLR-QKEWWQLBSA-N |
| XLogP | 1.84 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.29 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |