C12H20O3 — CID 13164271
12-oxatricyclo[4.4.3.01,6]tridecane-3,9-diol (PubChem CID 13164271) has the molecular formula C12H20O3 and a molecular weight of 212.29 g/mol. Its IUPAC name is 12-oxatricyclo[4.4.3.01,6]tridecane-3,9-diol.
| Compound Name | 12-oxatricyclo[4.4.3.01,6]tridecane-3,9-diol |
|---|---|
| PubChem CID | 13164271 |
| Molecular Formula | C12H20O3 |
| Molecular Weight | 212.29 g/mol |
| Exact Mass | 212.14 |
| IUPAC Name | 12-oxatricyclo[4.4.3.01,6]tridecane-3,9-diol |
| SMILES | OC1CCC23CCC(O)CC2(COC3)C1 |
| InChI | InChI=1S/C12H20O3/c13-9-1-3-11-4-2-10(14)6-12(11,5-9)8-15-7-11/h9-10,13-14H,1-8H2 |
| InChIKey | IKIUSBRRDAMWCI-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.29 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |