C13H19ClO2S — CID 98163671
(1S,6R,11R)-11-chloro-3-methyl-12λ6-thiatricyclo[4.4.3.01,6]tridec-3-ene 12,12-dioxide (PubChem CID 98163671) has the molecular formula C13H19ClO2S and a molecular weight of 274.81 g/mol. Its IUPAC name is (1S,6R,11R)-11-chloro-3-methyl-12λ6-thiatricyclo[4.4.3.01,6]tridec-3-ene 12,12-dioxide.
| Compound Name | (1S,6R,11R)-11-chloro-3-methyl-12λ6-thiatricyclo[4.4.3.01,6]tridec-3-ene 12,12-dioxide |
|---|---|
| PubChem CID | 98163671 |
| Molecular Formula | C13H19ClO2S |
| Molecular Weight | 274.81 g/mol |
| Exact Mass | 274.08 |
| IUPAC Name | (1S,6R,11R)-11-chloro-3-methyl-12λ6-thiatricyclo[4.4.3.01,6]tridec-3-ene 12,12-dioxide |
| SMILES | CC1=CC[C@]23CCCC[C@@]2(C1)[C@@H](Cl)S(=O)(=O)C3 |
| InChI | InChI=1S/C13H19ClO2S/c1-10-4-7-12-5-2-3-6-13(12,8-10)11(14)17(15,16)9-12/h4,11H,2-3,5-9H2,1H3/t11-,12-,13+/m0/s1 |
| InChIKey | UQGLEFDMYZPYIK-RWMBFGLXSA-N |
| XLogP | 3.27 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.81 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|