C10H12O2S — CID 98162256
(1R,6R)-8λ6-thiatricyclo[4.3.2.01,6]undeca-3,10-diene 8,8-dioxide (PubChem CID 98162256) has the molecular formula C10H12O2S and a molecular weight of 196.27 g/mol. Its IUPAC name is (1R,6R)-8λ6-thiatricyclo[4.3.2.01,6]undeca-3,10-diene 8,8-dioxide.
| Compound Name | (1R,6R)-8λ6-thiatricyclo[4.3.2.01,6]undeca-3,10-diene 8,8-dioxide |
|---|---|
| PubChem CID | 98162256 |
| Molecular Formula | C10H12O2S |
| Molecular Weight | 196.27 g/mol |
| Exact Mass | 196.06 |
| IUPAC Name | (1R,6R)-8λ6-thiatricyclo[4.3.2.01,6]undeca-3,10-diene 8,8-dioxide |
| SMILES | O=S1(=O)C[C@]23C=C[C@@]2(CC=CC3)C1 |
| InChI | InChI=1S/C10H12O2S/c11-13(12)7-9-3-1-2-4-10(9,8-13)6-5-9/h1-2,5-6H,3-4,7-8H2/t9-,10-/m0/s1 |
| InChIKey | WKDVQIRWPOFCOB-UWVGGRQHSA-N |
| XLogP | 1.31 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.27 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|