C14H14O3 — CID 100896680
methyl (1R,2R,5R,6S,7R,10R)-11-oxapentacyclo[4.4.1.12,5.17,10.01,6]trideca-3,8-diene-3-carboxylate (PubChem CID 100896680) has the molecular formula C14H14O3 and a molecular weight of 230.26 g/mol. Its IUPAC name is methyl (1R,2R,5R,6S,7R,10R)-11-oxapentacyclo[4.4.1.12,5.17,10.01,6]trideca-3,8-diene-3-carboxylate.
| Compound Name | methyl (1R,2R,5R,6S,7R,10R)-11-oxapentacyclo[4.4.1.12,5.17,10.01,6]trideca-3,8-diene-3-carboxylate |
|---|---|
| PubChem CID | 100896680 |
| Molecular Formula | C14H14O3 |
| Molecular Weight | 230.26 g/mol |
| Exact Mass | 230.09 |
| IUPAC Name | methyl (1R,2R,5R,6S,7R,10R)-11-oxapentacyclo[4.4.1.12,5.17,10.01,6]trideca-3,8-diene-3-carboxylate |
| SMILES | COC(=O)C1=C[C@H]2C[C@H]1[C@@]13O[C@@]21[C@H]1C=C[C@H]3C1 |
| InChI | InChI=1S/C14H14O3/c1-16-12(15)10-5-9-6-11(10)14-8-3-2-7(4-8)13(9,14)17-14/h2-3,5,7-9,11H,4,6H2,1H3/t7-,8-,9-,11+,13-,14+/m0/s1 |
| InChIKey | BZEWGLLZWGCJIE-FPZGPCESSA-N |
| XLogP | 1.45 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.26 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|