C22H32O5Si2 — CID 125034321
dimethyl (1S,2R,5R,6R,7R,10R,13R)-2,13-bis(trimethylsilyl)-11-oxapentacyclo[4.4.1.12,5.17,10.01,6]trideca-3,8-diene-3,4-dicarboxylate (PubChem CID 125034321) has the molecular formula C22H32O5Si2 and a molecular weight of 432.67 g/mol. Its IUPAC name is dimethyl (1S,2R,5R,6R,7R,10R,13R)-2,13-bis(trimethylsilyl)-11-oxapentacyclo[4.4.1.12,5.17,10.01,6]trideca-3,8-diene-3,4-dicarboxylate.
| Compound Name | dimethyl (1S,2R,5R,6R,7R,10R,13R)-2,13-bis(trimethylsilyl)-11-oxapentacyclo[4.4.1.12,5.17,10.01,6]trideca-3,8-diene-3,4-dicarboxylate |
|---|---|
| PubChem CID | 125034321 |
| Molecular Formula | C22H32O5Si2 |
| Molecular Weight | 432.67 g/mol |
| Exact Mass | 432.18 |
| IUPAC Name | dimethyl (1S,2R,5R,6R,7R,10R,13R)-2,13-bis(trimethylsilyl)-11-oxapentacyclo[4.4.1.12,5.17,10.01,6]trideca-3,8-diene-3,4-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)[C@]2([Si](C)(C)C)[C@H]([Si](C)(C)C)[C@H]1[C@@]13O[C@@]12[C@H]1C=C[C@H]3C1 |
| InChI | InChI=1S/C22H32O5Si2/c1-25-18(23)14-15-17(28(3,4)5)21(29(6,7)8,16(14)19(24)26-2)22-13-10-9-12(11-13)20(15,22)27-22/h9-10,12-13,15,17H,11H2,1-8H3/t12-,13-,15-,17+,20+,21-,22-/m0/s1 |
| InChIKey | ISHMZMOCWJFPSR-WBPIKPOJSA-N |
| XLogP | 3.77 |
| TPSA | 65.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.67 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|