C22H34O4Si2 — CID 125033994
dimethyl (1S,3R,6R,8S,12S)-3,12-bis(trimethylsilyl)tetracyclo[6.2.1.13,6.02,7]dodeca-2(7),4-diene-4,5-dicarboxylate (PubChem CID 125033994) has the molecular formula C22H34O4Si2 and a molecular weight of 418.68 g/mol. Its IUPAC name is dimethyl (1S,3R,6R,8S,12S)-3,12-bis(trimethylsilyl)tetracyclo[6.2.1.13,6.02,7]dodeca-2(7),4-diene-4,5-dicarboxylate.
| Compound Name | dimethyl (1S,3R,6R,8S,12S)-3,12-bis(trimethylsilyl)tetracyclo[6.2.1.13,6.02,7]dodeca-2(7),4-diene-4,5-dicarboxylate |
|---|---|
| PubChem CID | 125033994 |
| Molecular Formula | C22H34O4Si2 |
| Molecular Weight | 418.68 g/mol |
| Exact Mass | 418.20 |
| IUPAC Name | dimethyl (1S,3R,6R,8S,12S)-3,12-bis(trimethylsilyl)tetracyclo[6.2.1.13,6.02,7]dodeca-2(7),4-diene-4,5-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)[C@]2([Si](C)(C)C)C3=C([C@H]4CC[C@H]3C4)[C@H]1[C@@H]2[Si](C)(C)C |
| InChI | InChI=1S/C22H34O4Si2/c1-25-20(23)16-15-14-12-9-10-13(11-12)17(14)22(28(6,7)8,18(16)21(24)26-2)19(15)27(3,4)5/h12-13,15,19H,9-11H2,1-8H3/t12-,13-,15+,19-,22+/m0/s1 |
| InChIKey | GNXSXLLAJRJPEL-RMGRZXHESA-N |
| XLogP | 4.79 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.68 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|