About methyl tetracyclo[6.2.1.13,6.02,7]dodec-2(7)-ene-4-carboxylate
methyl tetracyclo[6.2.1.13,6.02,7]dodec-2(7)-ene-4-carboxylate (PubChem CID 12651737) has the molecular formula C14H18O2
and a molecular weight of 218.30 g/mol. Its IUPAC name is methyl tetracyclo[6.2.1.13,6.02,7]dodec-2(7)-ene-4-carboxylate.
Molecular Properties
| Compound Name | methyl tetracyclo[6.2.1.13,6.02,7]dodec-2(7)-ene-4-carboxylate |
| PubChem CID | 12651737 |
| Molecular Formula | C14H18O2 |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.13 |
| IUPAC Name | methyl tetracyclo[6.2.1.13,6.02,7]dodec-2(7)-ene-4-carboxylate |
| SMILES | COC(=O)C1CC2CC1C1=C2C2CCC1C2 |
| InChI | InChI=1S/C14H18O2/c1-16-14(15)11-6-9-5-10(11)13-8-3-2-7(4-8)12(9)13/h7-11H,2-6H2,1H3 |
| InChIKey | MOOOBMFVCSCOAY-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze methyl tetracyclo[6.2.1.13,6.02,7]dodec-2(7)-ene-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl tetracyclo[6.2.1.13,6.02,7]dodec-2(7)-ene-4-carboxylate?
The IUPAC name of methyl tetracyclo[6.2.1.13,6.02,7]dodec-2(7)-ene-4-carboxylate (CID 12651737) is methyl tetracyclo[6.2.1.13,6.02,7]dodec-2(7)-ene-4-carboxylate.
What is the SMILES notation for methyl tetracyclo[6.2.1.13,6.02,7]dodec-2(7)-ene-4-carboxylate?
The canonical SMILES for methyl tetracyclo[6.2.1.13,6.02,7]dodec-2(7)-ene-4-carboxylate is COC(=O)C1CC2CC1C1=C2C2CCC1C2.
What is the InChIKey of methyl tetracyclo[6.2.1.13,6.02,7]dodec-2(7)-ene-4-carboxylate?
The InChIKey is MOOOBMFVCSCOAY-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18O2/c1-16-14(15)11-6-9-5-10(11)13-8-3-2-7(4-8)12(9)13/h7-11H,2-6H2,1H3.
What are the key properties of methyl tetracyclo[6.2.1.13,6.02,7]dodec-2(7)-ene-4-carboxylate?
methyl tetracyclo[6.2.1.13,6.02,7]dodec-2(7)-ene-4-carboxylate has a molecular weight of 218.30 g/mol, XLogP of 2.54, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl tetracyclo[6.2.1.13,6.02,7]dodec-2(7)-ene-4-carboxylate is sourced from PubChem (CID 12651737), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).