C19H24O5 — CID 125036197
dimethyl (1R,2R,5R,7R,8S,11S)-14,14-dimethyl-12-oxapentacyclo[5.4.1.12,5.18,11.01,7]tetradec-3-ene-3,4-dicarboxylate (PubChem CID 125036197) has the molecular formula C19H24O5 and a molecular weight of 332.40 g/mol. Its IUPAC name is dimethyl (1R,2R,5R,7R,8S,11S)-14,14-dimethyl-12-oxapentacyclo[5.4.1.12,5.18,11.01,7]tetradec-3-ene-3,4-dicarboxylate.
| Compound Name | dimethyl (1R,2R,5R,7R,8S,11S)-14,14-dimethyl-12-oxapentacyclo[5.4.1.12,5.18,11.01,7]tetradec-3-ene-3,4-dicarboxylate |
|---|---|
| PubChem CID | 125036197 |
| Molecular Formula | C19H24O5 |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.16 |
| IUPAC Name | dimethyl (1R,2R,5R,7R,8S,11S)-14,14-dimethyl-12-oxapentacyclo[5.4.1.12,5.18,11.01,7]tetradec-3-ene-3,4-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)[C@H]2C(C)(C)[C@H]1C[C@]13O[C@]21[C@H]1CC[C@H]3C1 |
| InChI | InChI=1S/C19H24O5/c1-17(2)11-8-18-9-5-6-10(7-9)19(18,24-18)14(17)13(16(21)23-4)12(11)15(20)22-3/h9-11,14H,5-8H2,1-4H3/t9-,10-,11-,14-,18+,19+/m0/s1 |
| InChIKey | UZDTWTNTFMXEGJ-YPAFOPHSSA-N |
| XLogP | 2.24 |
| TPSA | 65.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|