C23H21FO5 — CID 125035575
dimethyl (1R,2R,5R,6R,7S,10S)-13-[(4-fluorophenyl)methylidene]-11-oxapentacyclo[4.4.1.12,5.17,10.01,6]tridec-3-ene-3,4-dicarboxylate (PubChem CID 125035575) has the molecular formula C23H21FO5 and a molecular weight of 396.41 g/mol. Its IUPAC name is dimethyl (1R,2R,5R,6R,7S,10S)-13-[(4-fluorophenyl)methylidene]-11-oxapentacyclo[4.4.1.12,5.17,10.01,6]tridec-3-ene-3,4-dicarboxylate.
| Compound Name | dimethyl (1R,2R,5R,6R,7S,10S)-13-[(4-fluorophenyl)methylidene]-11-oxapentacyclo[4.4.1.12,5.17,10.01,6]tridec-3-ene-3,4-dicarboxylate |
|---|---|
| PubChem CID | 125035575 |
| Molecular Formula | C23H21FO5 |
| Molecular Weight | 396.41 g/mol |
| Exact Mass | 396.14 |
| IUPAC Name | dimethyl (1R,2R,5R,6R,7S,10S)-13-[(4-fluorophenyl)methylidene]-11-oxapentacyclo[4.4.1.12,5.17,10.01,6]tridec-3-ene-3,4-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)[C@H]2C(=Cc3ccc(F)cc3)[C@H]1[C@@]13O[C@]21[C@H]1CC[C@H]3C1 |
| InChI | InChI=1S/C23H21FO5/c1-27-20(25)16-17(21(26)28-2)19-15(9-11-3-7-14(24)8-4-11)18(16)22-12-5-6-13(10-12)23(19,22)29-22/h3-4,7-9,12-13,18-19H,5-6,10H2,1-2H3/t12-,13-,18+,19+,22+,23+/m0/s1 |
| InChIKey | QHBNCLKKAWMDHB-OCIDSVSXSA-N |
| XLogP | 3.05 |
| TPSA | 65.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.41 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|