C20H14F2NO2S+ — CID 171721978
methyl 3-(2,8-difluoro-10H-phenothiazin-5-ium-5-yl)benzoate (PubChem CID 171721978) has the molecular formula C20H14F2NO2S+ and a molecular weight of 370.40 g/mol. Its IUPAC name is methyl 3-(2,8-difluoro-10H-phenothiazin-5-ium-5-yl)benzoate.
| Compound Name | methyl 3-(2,8-difluoro-10H-phenothiazin-5-ium-5-yl)benzoate |
|---|---|
| PubChem CID | 171721978 |
| Molecular Formula | C20H14F2NO2S+ |
| Molecular Weight | 370.40 g/mol |
| Exact Mass | 370.07 |
| IUPAC Name | methyl 3-(2,8-difluoro-10H-phenothiazin-5-ium-5-yl)benzoate |
| SMILES | COC(=O)c1cccc([S+]2c3ccc(F)cc3Nc3cc(F)ccc32)c1 |
| InChI | InChI=1S/C20H14F2NO2S/c1-25-20(24)12-3-2-4-15(9-12)26-18-7-5-13(21)10-16(18)23-17-11-14(22)6-8-19(17)26/h2-11,23H,1H3/q+1 |
| InChIKey | KNPCPQKTFIQCDH-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.40 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|