C17H20O3 — CID 125028611
methyl (1S,2R,5S,6S,7S,10S)-13-propan-2-ylidene-11-oxapentacyclo[4.4.1.12,5.17,10.01,6]tridec-3-ene-3-carboxylate (PubChem CID 125028611) has the molecular formula C17H20O3 and a molecular weight of 272.34 g/mol. Its IUPAC name is methyl (1S,2R,5S,6S,7S,10S)-13-propan-2-ylidene-11-oxapentacyclo[4.4.1.12,5.17,10.01,6]tridec-3-ene-3-carboxylate.
| Compound Name | methyl (1S,2R,5S,6S,7S,10S)-13-propan-2-ylidene-11-oxapentacyclo[4.4.1.12,5.17,10.01,6]tridec-3-ene-3-carboxylate |
|---|---|
| PubChem CID | 125028611 |
| Molecular Formula | C17H20O3 |
| Molecular Weight | 272.34 g/mol |
| Exact Mass | 272.14 |
| IUPAC Name | methyl (1S,2R,5S,6S,7S,10S)-13-propan-2-ylidene-11-oxapentacyclo[4.4.1.12,5.17,10.01,6]tridec-3-ene-3-carboxylate |
| SMILES | COC(=O)C1=C[C@H]2C(=C(C)C)[C@H]1[C@]13O[C@@]21[C@H]1CC[C@H]3C1 |
| InChI | InChI=1S/C17H20O3/c1-8(2)13-12-7-11(15(18)19-3)14(13)17-10-5-4-9(6-10)16(12,17)20-17/h7,9-10,12,14H,4-6H2,1-3H3/t9-,10-,12-,14-,16-,17-/m0/s1 |
| InChIKey | JCQIKYNJGLQKSV-WRFKPNINSA-N |
| XLogP | 2.62 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.34 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|