C13H21N3OS — CID 100897500
N-[(3aS,4R,7aR)-2,3,3a,4,5,6,7,7a-octahydro-1-benzofuran-4-yl]-5-propyl-1,3,4-thiadiazol-2-amine (PubChem CID 100897500) has the molecular formula C13H21N3OS and a molecular weight of 267.40 g/mol. Its IUPAC name is N-[(3aS,4R,7aR)-2,3,3a,4,5,6,7,7a-octahydro-1-benzofuran-4-yl]-5-propyl-1,3,4-thiadiazol-2-amine.
| Compound Name | N-[(3aS,4R,7aR)-2,3,3a,4,5,6,7,7a-octahydro-1-benzofuran-4-yl]-5-propyl-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 100897500 |
| Molecular Formula | C13H21N3OS |
| Molecular Weight | 267.40 g/mol |
| Exact Mass | 267.14 |
| IUPAC Name | N-[(3aS,4R,7aR)-2,3,3a,4,5,6,7,7a-octahydro-1-benzofuran-4-yl]-5-propyl-1,3,4-thiadiazol-2-amine |
| SMILES | CCCc1nnc(N[C@@H]2CCC[C@H]3OCC[C@@H]23)s1 |
| InChI | InChI=1S/C13H21N3OS/c1-2-4-12-15-16-13(18-12)14-10-5-3-6-11-9(10)7-8-17-11/h9-11H,2-8H2,1H3,(H,14,16)/t9-,10+,11+/m0/s1 |
| InChIKey | CRYQUYAUJGAQQB-HBNTYKKESA-N |
| XLogP | 2.86 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.40 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |