C17H12NO4S2- — CID 10089853
[2-[3-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenyl]phenyl]methanesulfinate (PubChem CID 10089853) has the molecular formula C17H12NO4S2- and a molecular weight of 358.42 g/mol. Its IUPAC name is [2-[3-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenyl]phenyl]methanesulfinate.
| Compound Name | [2-[3-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenyl]phenyl]methanesulfinate |
|---|---|
| PubChem CID | 10089853 |
| Molecular Formula | C17H12NO4S2- |
| Molecular Weight | 358.42 g/mol |
| Exact Mass | 358.02 |
| IUPAC Name | [2-[3-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenyl]phenyl]methanesulfinate |
| SMILES | O=C1NC(=O)/C(=C/c2cccc(-c3ccccc3CS(=O)[O-])c2)S1 |
| InChI | InChI=1S/C17H13NO4S2/c19-16-15(23-17(20)18-16)9-11-4-3-6-12(8-11)14-7-2-1-5-13(14)10-24(21)22/h1-9H,10H2,(H,21,22)(H,18,19,20)/p-1/b15-9- |
| InChIKey | OERPFFCJIGUXFU-DHDCSXOGSA-M |
| XLogP | 3.06 |
| TPSA | 86.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.42 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|