C19H15IN2O2 — CID 1009004
(2R)-2-(furan-2-yl)-6-iodo-3-(3-methylphenyl)-1,2-dihydroquinazolin-4-one (PubChem CID 1009004) has the molecular formula C19H15IN2O2 and a molecular weight of 430.25 g/mol. Its IUPAC name is (2R)-2-(furan-2-yl)-6-iodo-3-(3-methylphenyl)-1,2-dihydroquinazolin-4-one.
| Compound Name | (2R)-2-(furan-2-yl)-6-iodo-3-(3-methylphenyl)-1,2-dihydroquinazolin-4-one |
|---|---|
| PubChem CID | 1009004 |
| Molecular Formula | C19H15IN2O2 |
| Molecular Weight | 430.25 g/mol |
| Exact Mass | 430.02 |
| IUPAC Name | (2R)-2-(furan-2-yl)-6-iodo-3-(3-methylphenyl)-1,2-dihydroquinazolin-4-one |
| SMILES | Cc1cccc(N2C(=O)c3cc(I)ccc3N[C@H]2c2ccco2)c1 |
| InChI | InChI=1S/C19H15IN2O2/c1-12-4-2-5-14(10-12)22-18(17-6-3-9-24-17)21-16-8-7-13(20)11-15(16)19(22)23/h2-11,18,21H,1H3/t18-/m1/s1 |
| InChIKey | JNYWUUGYNVQABB-GOSISDBHSA-N |
| XLogP | 4.96 |
| TPSA | 45.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.25 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|