C25H25IN2O3 — CID 4642062
2-(4-butoxyphenyl)-6-iodo-3-(3-methoxyphenyl)-1,2-dihydroquinazolin-4-one (PubChem CID 4642062) has the molecular formula C25H25IN2O3 and a molecular weight of 528.39 g/mol. Its IUPAC name is 2-(4-butoxyphenyl)-6-iodo-3-(3-methoxyphenyl)-1,2-dihydroquinazolin-4-one.
| Compound Name | 2-(4-butoxyphenyl)-6-iodo-3-(3-methoxyphenyl)-1,2-dihydroquinazolin-4-one |
|---|---|
| PubChem CID | 4642062 |
| Molecular Formula | C25H25IN2O3 |
| Molecular Weight | 528.39 g/mol |
| Exact Mass | 528.09 |
| IUPAC Name | 2-(4-butoxyphenyl)-6-iodo-3-(3-methoxyphenyl)-1,2-dihydroquinazolin-4-one |
| SMILES | CCCCOc1ccc(C2Nc3ccc(I)cc3C(=O)N2c2cccc(OC)c2)cc1 |
| InChI | InChI=1S/C25H25IN2O3/c1-3-4-14-31-20-11-8-17(9-12-20)24-27-23-13-10-18(26)15-22(23)25(29)28(24)19-6-5-7-21(16-19)30-2/h5-13,15-16,24,27H,3-4,14H2,1-2H3 |
| InChIKey | HDSSFIHAHJBJIU-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.39 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|