C23H20FIN2O4 — CID 7027315
(2S)-3-(3-fluorophenyl)-6-iodo-2-(2,4,5-trimethoxyphenyl)-1,2-dihydroquinazolin-4-one (PubChem CID 7027315) has the molecular formula C23H20FIN2O4 and a molecular weight of 534.33 g/mol. Its IUPAC name is (2S)-3-(3-fluorophenyl)-6-iodo-2-(2,4,5-trimethoxyphenyl)-1,2-dihydroquinazolin-4-one.
| Compound Name | (2S)-3-(3-fluorophenyl)-6-iodo-2-(2,4,5-trimethoxyphenyl)-1,2-dihydroquinazolin-4-one |
|---|---|
| PubChem CID | 7027315 |
| Molecular Formula | C23H20FIN2O4 |
| Molecular Weight | 534.33 g/mol |
| Exact Mass | 534.05 |
| IUPAC Name | (2S)-3-(3-fluorophenyl)-6-iodo-2-(2,4,5-trimethoxyphenyl)-1,2-dihydroquinazolin-4-one |
| SMILES | COc1cc(OC)c([C@H]2Nc3ccc(I)cc3C(=O)N2c2cccc(F)c2)cc1OC |
| InChI | InChI=1S/C23H20FIN2O4/c1-29-19-12-21(31-3)20(30-2)11-17(19)22-26-18-8-7-14(25)10-16(18)23(28)27(22)15-6-4-5-13(24)9-15/h4-12,22,26H,1-3H3/t22-/m0/s1 |
| InChIKey | PVUMOTOFWYQNOY-QFIPXVFZSA-N |
| XLogP | 5.23 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.33 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|