C17H32N2O — CID 100901011
N-[(3aS,4R,7aR)-2,3,3a,4,5,6,7,7a-octahydro-1-benzofuran-4-yl]-1-tert-butylpiperidin-4-amine (PubChem CID 100901011) has the molecular formula C17H32N2O and a molecular weight of 280.46 g/mol. Its IUPAC name is N-[(3aS,4R,7aR)-2,3,3a,4,5,6,7,7a-octahydro-1-benzofuran-4-yl]-1-tert-butylpiperidin-4-amine.
| Compound Name | N-[(3aS,4R,7aR)-2,3,3a,4,5,6,7,7a-octahydro-1-benzofuran-4-yl]-1-tert-butylpiperidin-4-amine |
|---|---|
| PubChem CID | 100901011 |
| Molecular Formula | C17H32N2O |
| Molecular Weight | 280.46 g/mol |
| Exact Mass | 280.25 |
| IUPAC Name | N-[(3aS,4R,7aR)-2,3,3a,4,5,6,7,7a-octahydro-1-benzofuran-4-yl]-1-tert-butylpiperidin-4-amine |
| SMILES | CC(C)(C)N1CCC(N[C@@H]2CCC[C@H]3OCC[C@@H]23)CC1 |
| InChI | InChI=1S/C17H32N2O/c1-17(2,3)19-10-7-13(8-11-19)18-15-5-4-6-16-14(15)9-12-20-16/h13-16,18H,4-12H2,1-3H3/t14-,15+,16+/m0/s1 |
| InChIKey | MOINEFTZFLKOLB-ARFHVFGLSA-N |
| XLogP | 2.80 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.46 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |